Products 1185315-89-2
CAS 1185315-89-2 is the registry number for 4–Chloro–6–(ethyl–d5)–pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4-chloro-6-(1,1,2,2,2-pentadeuterioethyl)pyrimidine (CAS 1185315-89-2) is a chemical compound with the molecular formula C6H7ClN2 and a molecular weight of 147.62 g/mol. IUPAC name: 4-chloro-6-(1,1,2,2,2-pentadeuterioethyl)pyrimidine. InChIKey: MFZPGDQOHZBCRW-ZBJDZAJPSA-N.
| Molecular formula | C6H7ClN2 |
|---|---|
| Molecular weight | 147.62 g/mol |
| IUPAC name | 4-chloro-6-(1,1,2,2,2-pentadeuterioethyl)pyrimidine |
| InChIKey | MFZPGDQOHZBCRW-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=CC(=NC=N1)Cl |
Computed by PubChem (NCBI)