Products 1185316-32-8
CAS 1185316-32-8 is the registry number for 4，6–Dichloro–2–(iso–propyl–d7)–pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4,6-dichloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyrimidine (CAS 1185316-32-8) is a chemical compound with the molecular formula C7H8Cl2N2 and a molecular weight of 198.10 g/mol. IUPAC name: 4,6-dichloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyrimidine. InChIKey: GZRKQOQFSXBYTB-UAVYNJCWSA-N.
| Molecular formula | C7H8Cl2N2 |
|---|---|
| Molecular weight | 198.10 g/mol |
| IUPAC name | 4,6-dichloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyrimidine |
| InChIKey | GZRKQOQFSXBYTB-UAVYNJCWSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=NC(=CC(=N1)Cl)Cl)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)