CAS 1185316-44-2 is the registry number for 2–(Ethoxy–d5)bromobenzene. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
1-bromo-2-(1,1,2,2,2-pentadeuterioethoxy)benzene (CAS 1185316-44-2) is a chemical compound with the molecular formula C8H9BrO and a molecular weight of 206.09 g/mol. IUPAC name: 1-bromo-2-(1,1,2,2,2-pentadeuterioethoxy)benzene. InChIKey: JVEQWIQHHWNMQX-ZBJDZAJPSA-N.
| Molecular formula | C8H9BrO |
|---|---|
| Molecular weight | 206.09 g/mol |
| IUPAC name | 1-bromo-2-(1,1,2,2,2-pentadeuterioethoxy)benzene |
| InChIKey | JVEQWIQHHWNMQX-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=CC=CC=C1Br |
Computed by PubChem (NCBI)