CAS 1185316-73-7 is the registry number for 5–(methyl–d3)pyrazin–2–ol. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
5-(trideuteriomethyl)-1H-pyrazin-2-one (CAS 1185316-73-7) is a chemical compound with the molecular formula C5H6N2O and a molecular weight of 113.13 g/mol. IUPAC name: 5-(trideuteriomethyl)-1H-pyrazin-2-one. InChIKey: MJJNWPBBFIRYCW-FIBGUPNXSA-N.
| Molecular formula | C5H6N2O |
|---|---|
| Molecular weight | 113.13 g/mol |
| IUPAC name | 5-(trideuteriomethyl)-1H-pyrazin-2-one |
| InChIKey | MJJNWPBBFIRYCW-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CNC(=O)C=N1 |
Computed by PubChem (NCBI)