CAS 1185316-74-8 is the registry number for 4–Chloro–2–methylthio–6–(iso–propyl–d7)–pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4-chloro-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-methylsulfanylpyrimidine (CAS 1185316-74-8) is a chemical compound with the molecular formula C8H11ClN2S and a molecular weight of 209.75 g/mol. IUPAC name: 4-chloro-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-methylsulfanylpyrimidine. InChIKey: ICLCYJSVXCHCAR-TXVPSQRDSA-N.
| Molecular formula | C8H11ClN2S |
|---|---|
| Molecular weight | 209.75 g/mol |
| IUPAC name | 4-chloro-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-methylsulfanylpyrimidine |
| InChIKey | ICLCYJSVXCHCAR-TXVPSQRDSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=CC(=NC(=N1)SC)Cl)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)