CAS 1185316-91-9 is the registry number for 2–Chloro–3–cyano–6–(methyl–d3)–pyridine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
2-chloro-6-(trideuteriomethyl)pyridine-3-carbonitrile (CAS 1185316-91-9) is a chemical compound with the molecular formula C7H5ClN2 and a molecular weight of 155.60 g/mol. IUPAC name: 2-chloro-6-(trideuteriomethyl)pyridine-3-carbonitrile. InChIKey: YSBNBAYNISAUIT-FIBGUPNXSA-N.
| Molecular formula | C7H5ClN2 |
|---|---|
| Molecular weight | 155.60 g/mol |
| IUPAC name | 2-chloro-6-(trideuteriomethyl)pyridine-3-carbonitrile |
| InChIKey | YSBNBAYNISAUIT-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC(=C(C=C1)C#N)Cl |
Computed by PubChem (NCBI)