Products 1185317-02-5
CAS 1185317-02-5 is the registry number for 3–Bromo–5–methyl–6–(methoxy–d3)–pyridine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
5-bromo-3-methyl-2-(trideuteriomethoxy)pyridine (CAS 1185317-02-5) is a chemical compound with the molecular formula C7H8BrNO and a molecular weight of 205.07 g/mol. IUPAC name: 5-bromo-3-methyl-2-(trideuteriomethoxy)pyridine. InChIKey: RHYCFMXPPGZHAW-BMSJAHLVSA-N.
| Molecular formula | C7H8BrNO |
|---|---|
| Molecular weight | 205.07 g/mol |
| IUPAC name | 5-bromo-3-methyl-2-(trideuteriomethoxy)pyridine |
| InChIKey | RHYCFMXPPGZHAW-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC1=NC=C(C=C1C)Br |
Computed by PubChem (NCBI)