CAS 1185317-43-4 is the registry number for 2–Amino–4–(ethyl–d5)–pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4-(1,1,2,2,2-pentadeuterioethyl)pyrimidin-2-amine (CAS 1185317-43-4) is a chemical compound with the molecular formula C6H9N3 and a molecular weight of 128.19 g/mol. IUPAC name: 4-(1,1,2,2,2-pentadeuterioethyl)pyrimidin-2-amine. InChIKey: JEXFHPIOWFXDCH-ZBJDZAJPSA-N.
| Molecular formula | C6H9N3 |
|---|---|
| Molecular weight | 128.19 g/mol |
| IUPAC name | 4-(1,1,2,2,2-pentadeuterioethyl)pyrimidin-2-amine |
| InChIKey | JEXFHPIOWFXDCH-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=NC(=NC=C1)N |
Computed by PubChem (NCBI)