Products 1185317-45-6
CAS 1185317-45-6 is the registry number for 4，6–Dichloro–2–(methyl–d3)–pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4,6-dichloro-2-(trideuteriomethyl)pyrimidine (CAS 1185317-45-6) is a chemical compound with the molecular formula C5H4Cl2N2 and a molecular weight of 166.02 g/mol. IUPAC name: 4,6-dichloro-2-(trideuteriomethyl)pyrimidine. InChIKey: FIMUTBLUWQGTIJ-FIBGUPNXSA-N.
| Molecular formula | C5H4Cl2N2 |
|---|---|
| Molecular weight | 166.02 g/mol |
| IUPAC name | 4,6-dichloro-2-(trideuteriomethyl)pyrimidine |
| InChIKey | FIMUTBLUWQGTIJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC(=CC(=N1)Cl)Cl |
Computed by PubChem (NCBI)