Products 1185317-67-2
CAS 1185317-67-2 is the registry number for 3–Hydroxy–6–(iso–propyl–d7)–pyridine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyridin-3-ol (CAS 1185317-67-2) is a chemical compound with the molecular formula C8H11NO and a molecular weight of 144.22 g/mol. IUPAC name: 6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyridin-3-ol. InChIKey: XJTYVWSIHYOBHW-NWOXSKRJSA-N.
| Molecular formula | C8H11NO |
|---|---|
| Molecular weight | 144.22 g/mol |
| IUPAC name | 6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyridin-3-ol |
| InChIKey | XJTYVWSIHYOBHW-NWOXSKRJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=NC=C(C=C1)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)