CAS 1185317-80-9 is the registry number for 4,6–Dichloro–2–(ethoxy–d5)–pyrimidine. Offered by: GLPBio. Available pack sizes: 5mg.
4,6-dichloro-2-(1,1,2,2,2-pentadeuterioethoxy)pyrimidine (CAS 1185317-80-9) is a chemical compound with the molecular formula C6H6Cl2N2O and a molecular weight of 198.06 g/mol. IUPAC name: 4,6-dichloro-2-(1,1,2,2,2-pentadeuterioethoxy)pyrimidine. InChIKey: CVMAOIALLIBNNZ-ZBJDZAJPSA-N.
| Molecular formula | C6H6Cl2N2O |
|---|---|
| Molecular weight | 198.06 g/mol |
| IUPAC name | 4,6-dichloro-2-(1,1,2,2,2-pentadeuterioethoxy)pyrimidine |
| InChIKey | CVMAOIALLIBNNZ-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=NC(=CC(=N1)Cl)Cl |
Computed by PubChem (NCBI)