CAS 1185317-83-2 is the registry number for 4–Chloro–5–fluoro–2–(n–propyl–d7)–pyrimidine. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
4-chloro-5-fluoro-2-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyrimidine (CAS 1185317-83-2) is a chemical compound with the molecular formula C7H8ClFN2 and a molecular weight of 181.64 g/mol. IUPAC name: 4-chloro-5-fluoro-2-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyrimidine. InChIKey: DIADICMNRQLIEW-NCKGIQLSSA-N.
| Molecular formula | C7H8ClFN2 |
|---|---|
| Molecular weight | 181.64 g/mol |
| IUPAC name | 4-chloro-5-fluoro-2-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyrimidine |
| InChIKey | DIADICMNRQLIEW-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=NC=C(C(=N1)Cl)F |
Computed by PubChem (NCBI)