CAS 1185318-54-0 is the registry number for 1–Chloro–4–(methyl–d3)–phthalazine. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
1-chloro-4-(trideuteriomethyl)phthalazine (CAS 1185318-54-0) is a chemical compound with the molecular formula C9H7ClN2 and a molecular weight of 181.63 g/mol. IUPAC name: 1-chloro-4-(trideuteriomethyl)phthalazine. InChIKey: IEDBAGGSOLFBBH-FIBGUPNXSA-N.
| Molecular formula | C9H7ClN2 |
|---|---|
| Molecular weight | 181.63 g/mol |
| IUPAC name | 1-chloro-4-(trideuteriomethyl)phthalazine |
| InChIKey | IEDBAGGSOLFBBH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NN=C(C2=CC=CC=C21)Cl |
Computed by PubChem (NCBI)