CAS 1185319-89-4 is the registry number for 2–Methylaminopyridine–d7. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
3,4,5,6-tetradeuterio-N-(trideuteriomethyl)pyridin-2-amine (CAS 1185319-89-4) is a chemical compound with the molecular formula C6H8N2 and a molecular weight of 115.18 g/mol. IUPAC name: 3,4,5,6-tetradeuterio-N-(trideuteriomethyl)pyridin-2-amine. InChIKey: SVEUVITYHIHZQE-AAYPNNLASA-N.
| Molecular formula | C6H8N2 |
|---|---|
| Molecular weight | 115.18 g/mol |
| IUPAC name | 3,4,5,6-tetradeuterio-N-(trideuteriomethyl)pyridin-2-amine |
| InChIKey | SVEUVITYHIHZQE-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])NC([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)