Products 1185319-98-5
CAS 1185319-98-5 is the registry number for 3–Bromo–2–fluoro–5–(methyl–d3)–pyridine. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
3-bromo-2-fluoro-5-(trideuteriomethyl)pyridine (CAS 1185319-98-5) is a chemical compound with the molecular formula C6H5BrFN and a molecular weight of 193.03 g/mol. IUPAC name: 3-bromo-2-fluoro-5-(trideuteriomethyl)pyridine. InChIKey: FWKQBHMQYXTOTD-FIBGUPNXSA-N.
| Molecular formula | C6H5BrFN |
|---|---|
| Molecular weight | 193.03 g/mol |
| IUPAC name | 3-bromo-2-fluoro-5-(trideuteriomethyl)pyridine |
| InChIKey | FWKQBHMQYXTOTD-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=C(N=C1)F)Br |
Computed by PubChem (NCBI)