Products 1185320-05-1
CAS 1185320-05-1 is the registry number for 4–Bromo–3–(methyl–d3)–pyrazole. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
4-bromo-5-(trideuteriomethyl)-1H-pyrazole (CAS 1185320-05-1) is a chemical compound with the molecular formula C4H5BrN2 and a molecular weight of 164.02 g/mol. IUPAC name: 4-bromo-5-(trideuteriomethyl)-1H-pyrazole. InChIKey: IXQPRETWBGVNPJ-FIBGUPNXSA-N.
| Molecular formula | C4H5BrN2 |
|---|---|
| Molecular weight | 164.02 g/mol |
| IUPAC name | 4-bromo-5-(trideuteriomethyl)-1H-pyrazole |
| InChIKey | IXQPRETWBGVNPJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C=NN1)Br |
Computed by PubChem (NCBI)