Products 1185320-10-8
CAS 1185320-10-8 is the registry number for 2–Bromo–5–(methyl–d3)–furan. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
2-bromo-5-(trideuteriomethyl)furan (CAS 1185320-10-8) is a chemical compound with the molecular formula C5H5BrO and a molecular weight of 164.01 g/mol. IUPAC name: 2-bromo-5-(trideuteriomethyl)furan. InChIKey: VWGRESZTMULPDE-FIBGUPNXSA-N.
| Molecular formula | C5H5BrO |
|---|---|
| Molecular weight | 164.01 g/mol |
| IUPAC name | 2-bromo-5-(trideuteriomethyl)furan |
| InChIKey | VWGRESZTMULPDE-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=C(O1)Br |
Computed by PubChem (NCBI)