CAS 1185320-18-6 is the registry number for 4–Chloro–2,5–(dimethyl–d6)–thiazole. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
4-chloro-2,5-bis(trideuteriomethyl)-1,3-thiazole (CAS 1185320-18-6) is a chemical compound with the molecular formula C5H6ClNS and a molecular weight of 153.66 g/mol. IUPAC name: 4-chloro-2,5-bis(trideuteriomethyl)-1,3-thiazole. InChIKey: NVMXNNFQHUAEHW-WFGJKAKNSA-N.
| Molecular formula | C5H6ClNS |
|---|---|
| Molecular weight | 153.66 g/mol |
| IUPAC name | 4-chloro-2,5-bis(trideuteriomethyl)-1,3-thiazole |
| InChIKey | NVMXNNFQHUAEHW-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(N=C(S1)C([2H])([2H])[2H])Cl |
Computed by PubChem (NCBI)