Products 1185320-21-1
CAS 1185320-21-1 is the registry number for 2–Bromo–5–(acetyl–d3)–thiophene. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
1-(5-bromothiophen-2-yl)-2,2,2-trideuterioethanone (CAS 1185320-21-1) is a chemical compound with the molecular formula C6H5BrOS and a molecular weight of 208.09 g/mol. IUPAC name: 1-(5-bromothiophen-2-yl)-2,2,2-trideuterioethanone. InChIKey: IGBZCOWXSCWSHO-FIBGUPNXSA-N.
| Molecular formula | C6H5BrOS |
|---|---|
| Molecular weight | 208.09 g/mol |
| IUPAC name | 1-(5-bromothiophen-2-yl)-2,2,2-trideuterioethanone |
| InChIKey | IGBZCOWXSCWSHO-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C1=CC=C(S1)Br |
Computed by PubChem (NCBI)