CAS 1185320-22-2 is the registry number for 2–(n–Propyl–d7)–imidazole. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
2-(1,1,2,2,3,3,3-heptadeuteriopropyl)-1H-imidazole (CAS 1185320-22-2) is a chemical compound with the molecular formula C6H10N2 and a molecular weight of 117.20 g/mol. IUPAC name: 2-(1,1,2,2,3,3,3-heptadeuteriopropyl)-1H-imidazole. InChIKey: MKBBSFGKFMQPPC-NCKGIQLSSA-N.
| Molecular formula | C6H10N2 |
|---|---|
| Molecular weight | 117.20 g/mol |
| IUPAC name | 2-(1,1,2,2,3,3,3-heptadeuteriopropyl)-1H-imidazole |
| InChIKey | MKBBSFGKFMQPPC-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=NC=CN1 |
Computed by PubChem (NCBI)