CAS 1185320-23-3 is the registry number for 3–Chloro–4–(methyl–d3)–1,2,5–thiadiazole. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
3-chloro-4-(trideuteriomethyl)-1,2,5-thiadiazole (CAS 1185320-23-3) is a chemical compound with the molecular formula C3H3ClN2S and a molecular weight of 137.61 g/mol. IUPAC name: 3-chloro-4-(trideuteriomethyl)-1,2,5-thiadiazole. InChIKey: FCKDQQYRFKEHAE-FIBGUPNXSA-N.
| Molecular formula | C3H3ClN2S |
|---|---|
| Molecular weight | 137.61 g/mol |
| IUPAC name | 3-chloro-4-(trideuteriomethyl)-1,2,5-thiadiazole |
| InChIKey | FCKDQQYRFKEHAE-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NSN=C1Cl |
Computed by PubChem (NCBI)