CAS 118534-81-9 is the registry number for Fmoc-asp(o-1-ad)-oh, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S)-4-(1-adamantyloxy)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid (CAS 118534-81-9) is a chemical compound with the molecular formula C29H31NO6 and a molecular weight of 489.6 g/mol. IUPAC name: (2S)-4-(1-adamantyloxy)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid. InChIKey: VLMHFLIBCSCIRT-QDPBCONJSA-N.
| Molecular formula | C29H31NO6 |
|---|---|
| Molecular weight | 489.6 g/mol |
| IUPAC name | (2S)-4-(1-adamantyloxy)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
| InChIKey | VLMHFLIBCSCIRT-QDPBCONJSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)OC(=O)C[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)