CAS 1185369-69-0 is the registry number for 3-(Aminomethyl)-5-fluoroindolin-2-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
3-(aminomethyl)-5-fluoro-1,3-dihydroindol-2-one;hydrochloride (CAS 1185369-69-0) is a chemical compound with the molecular formula C9H10ClFN2O and a molecular weight of 216.64 g/mol. IUPAC name: 3-(aminomethyl)-5-fluoro-1,3-dihydroindol-2-one;hydrochloride. InChIKey: BUYNBWOPZRTTAW-UHFFFAOYSA-N.
| Molecular formula | C9H10ClFN2O |
|---|---|
| Molecular weight | 216.64 g/mol |
| IUPAC name | 3-(aminomethyl)-5-fluoro-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | BUYNBWOPZRTTAW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(C(=O)N2)CN.Cl |
Computed by PubChem (NCBI)