CAS 1185388-35-5 is the registry number for A110. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(1R)-1-[1-(4-chlorophenyl)triazol-4-yl]ethoxy]-1-oxidoquinolin-1-ium (CAS 1185388-35-5) is a chemical compound with the molecular formula C19H15ClN4O2 and a molecular weight of 366.8 g/mol. IUPAC name: 4-[(1R)-1-[1-(4-chlorophenyl)triazol-4-yl]ethoxy]-1-oxidoquinolin-1-ium. InChIKey: SVKHERCOWKMPQO-CYBMUJFWSA-N.
| Molecular formula | C19H15ClN4O2 |
|---|---|
| Molecular weight | 366.8 g/mol |
| IUPAC name | 4-[(1R)-1-[1-(4-chlorophenyl)triazol-4-yl]ethoxy]-1-oxidoquinolin-1-ium |
| InChIKey | SVKHERCOWKMPQO-CYBMUJFWSA-N |
| SMILES | C[C@H](C1=CN(N=N1)C2=CC=C(C=C2)Cl)OC3=CC=[N+](C4=CC=CC=C43)[O-] |
Computed by PubChem (NCBI)