Products 1185436-47-8

CAS 1185436-47-8 is the registry number for (1-Isopropyl-4-piperidinyl)acetic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(1-propan-2-ylpiperidin-4-yl)acetic acid;hydrate (CAS 1185436-47-8) is a chemical compound with the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. IUPAC name: 2-(1-propan-2-ylpiperidin-4-yl)acetic acid;hydrate. InChIKey: HQNSEIQRMVPILY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H21NO3
Molecular weight203.28 g/mol
IUPAC name2-(1-propan-2-ylpiperidin-4-yl)acetic acid;hydrate
InChIKeyHQNSEIQRMVPILY-UHFFFAOYSA-N
SMILESCC(C)N1CCC(CC1)CC(=O)O.O

Computed by PubChem (NCBI)