CAS 1185439-82-0 is the registry number for 2-(1H-1,2,3-Benzotriazol-1-yl)ethanamine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(benzotriazol-1-yl)ethanamine;hydrobromide (CAS 1185439-82-0) is a chemical compound with the molecular formula C8H11BrN4 and a molecular weight of 243.10 g/mol. IUPAC name: 2-(benzotriazol-1-yl)ethanamine;hydrobromide. InChIKey: RALFZIAXIQISHJ-UHFFFAOYSA-N.
| Molecular formula | C8H11BrN4 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 2-(benzotriazol-1-yl)ethanamine;hydrobromide |
| InChIKey | RALFZIAXIQISHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=NN2CCN.Br |
Computed by PubChem (NCBI)