Products 1185479-65-5

CAS 1185479-65-5 is the registry number for 1-(4-Methoxybenzoyl)piperazine trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

(4-methoxyphenyl)-piperazin-1-ylmethanone;2,2,2-trifluoroacetic acid (CAS 1185479-65-5) is a chemical compound with the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. IUPAC name: (4-methoxyphenyl)-piperazin-1-ylmethanone;2,2,2-trifluoroacetic acid. InChIKey: BIFUAGZYFLFUEJ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17F3N2O4
Molecular weight334.29 g/mol
IUPAC name(4-methoxyphenyl)-piperazin-1-ylmethanone;2,2,2-trifluoroacetic acid
InChIKeyBIFUAGZYFLFUEJ-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C(=O)N2CCNCC2.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)