Products 1185530-97-5

CAS 1185530-97-5 is the registry number for 1-(2-Fluorophenyl)-4-piperidinamine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-(2-fluorophenyl)piperidin-4-amine;oxalic acid (CAS 1185530-97-5) is a chemical compound with the molecular formula C13H17FN2O4 and a molecular weight of 284.28 g/mol. IUPAC name: 1-(2-fluorophenyl)piperidin-4-amine;oxalic acid. InChIKey: XRVCEZRZHWLUCW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17FN2O4
Molecular weight284.28 g/mol
IUPAC name1-(2-fluorophenyl)piperidin-4-amine;oxalic acid
InChIKeyXRVCEZRZHWLUCW-UHFFFAOYSA-N
SMILESC1CN(CCC1N)C2=CC=CC=C2F.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)