Products 1185547-15-2

CAS 1185547-15-2 is the registry number for N-(3-Fluorobenzyl)-n-methylguanidine sulfate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-[(3-fluorophenyl)methyl]-1-methylguanidine;sulfuric acid (CAS 1185547-15-2) is a chemical compound with the molecular formula C9H14FN3O4S and a molecular weight of 279.29 g/mol. IUPAC name: 1-[(3-fluorophenyl)methyl]-1-methylguanidine;sulfuric acid. InChIKey: LVZJSXRDDXIXQK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14FN3O4S
Molecular weight279.29 g/mol
IUPAC name1-[(3-fluorophenyl)methyl]-1-methylguanidine;sulfuric acid
InChIKeyLVZJSXRDDXIXQK-UHFFFAOYSA-N
SMILESCN(CC1=CC(=CC=C1)F)C(=N)N.OS(=O)(=O)O

Computed by PubChem (NCBI)