Products 1185568-51-7

CAS 1185568-51-7 is the registry number for 4-Bromo-2-methylpyridine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

4-bromo-2-methylpyridine;hydrobromide (CAS 1185568-51-7) is a chemical compound with the molecular formula C6H7Br2N and a molecular weight of 252.93 g/mol. IUPAC name: 4-bromo-2-methylpyridine;hydrobromide. InChIKey: NDMYLOFPYZXUSM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7Br2N
Molecular weight252.93 g/mol
IUPAC name4-bromo-2-methylpyridine;hydrobromide
InChIKeyNDMYLOFPYZXUSM-UHFFFAOYSA-N
SMILESCC1=NC=CC(=C1)Br.Br

Computed by PubChem (NCBI)