Products 1185709-64-1
CAS 1185709-64-1 is the registry number for HC2210. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(5-nitrofuran-2-yl)methyl]-4-(4-nitrophenyl)piperazine;oxalic acid (CAS 1185709-64-1) is a chemical compound with the molecular formula C17H18N4O9 and a molecular weight of 422.3 g/mol. IUPAC name: 1-[(5-nitrofuran-2-yl)methyl]-4-(4-nitrophenyl)piperazine;oxalic acid. InChIKey: KJBZNSKQKSWMBO-UHFFFAOYSA-N.
| Molecular formula | C17H18N4O9 |
|---|---|
| Molecular weight | 422.3 g/mol |
| IUPAC name | 1-[(5-nitrofuran-2-yl)methyl]-4-(4-nitrophenyl)piperazine;oxalic acid |
| InChIKey | KJBZNSKQKSWMBO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC=C(O2)[N+](=O)[O-])C3=CC=C(C=C3)[N+](=O)[O-].C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)