Products 1185712-52-0

CAS 1185712-52-0 is the registry number for 1-(4-Fluorophenyl)-4-piperidinamine acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Acetic acid;1-(4-fluorophenyl)piperidin-4-amine (CAS 1185712-52-0) is a chemical compound with the molecular formula C13H19FN2O2 and a molecular weight of 254.30 g/mol. IUPAC name: acetic acid;1-(4-fluorophenyl)piperidin-4-amine. InChIKey: OJTYOBPWQCFWAC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19FN2O2
Molecular weight254.30 g/mol
IUPAC nameacetic acid;1-(4-fluorophenyl)piperidin-4-amine
InChIKeyOJTYOBPWQCFWAC-UHFFFAOYSA-N
SMILESCC(=O)O.C1CN(CCC1N)C2=CC=C(C=C2)F

Computed by PubChem (NCBI)