CAS 1185770-65-3 appears in our catalog under these names: 2,6-Bis(aminomethyl)-4-chlorophenol dihydrochloride, 98%, 2,6-Bis(aminomethyl)-4-chlorophenol dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2,6-bis(aminomethyl)-4-chlorophenol;dihydrochloride (CAS 1185770-65-3) is a chemical compound with the molecular formula C8H13Cl3N2O and a molecular weight of 259.6 g/mol. IUPAC name: 2,6-bis(aminomethyl)-4-chlorophenol;dihydrochloride. InChIKey: PAQQQGWUVIFWPJ-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl3N2O |
|---|---|
| Molecular weight | 259.6 g/mol |
| IUPAC name | 2,6-bis(aminomethyl)-4-chlorophenol;dihydrochloride |
| InChIKey | PAQQQGWUVIFWPJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CN)O)CN)Cl.Cl.Cl |
Computed by PubChem (NCBI)