Products 1185770-65-3

CAS 1185770-65-3 appears in our catalog under these names: 2,6-Bis(aminomethyl)-4-chlorophenol dihydrochloride, 98%, 2,6-Bis(aminomethyl)-4-chlorophenol dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2,6-bis(aminomethyl)-4-chlorophenol;dihydrochloride (CAS 1185770-65-3) is a chemical compound with the molecular formula C8H13Cl3N2O and a molecular weight of 259.6 g/mol. IUPAC name: 2,6-bis(aminomethyl)-4-chlorophenol;dihydrochloride. InChIKey: PAQQQGWUVIFWPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13Cl3N2O
Molecular weight259.6 g/mol
IUPAC name2,6-bis(aminomethyl)-4-chlorophenol;dihydrochloride
InChIKeyPAQQQGWUVIFWPJ-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1CN)O)CN)Cl.Cl.Cl

Computed by PubChem (NCBI)