Products 1185845-15-1
CAS 1185845-15-1 is the registry number for NPY Y2 antagonist 1. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 5 mg.
N-[3-chloro-4-[4-(3-methoxypyridine-2-carbonyl)piperazin-1-yl]phenyl]-2-methyl-2-phenylpropanamide (CAS 1185845-15-1) is a chemical compound with the molecular formula C27H29ClN4O3 and a molecular weight of 493.0 g/mol. IUPAC name: N-[3-chloro-4-[4-(3-methoxypyridine-2-carbonyl)piperazin-1-yl]phenyl]-2-methyl-2-phenylpropanamide. InChIKey: WIHRUDKZTYLJLT-UHFFFAOYSA-N.
| Molecular formula | C27H29ClN4O3 |
|---|---|
| Molecular weight | 493.0 g/mol |
| IUPAC name | N-[3-chloro-4-[4-(3-methoxypyridine-2-carbonyl)piperazin-1-yl]phenyl]-2-methyl-2-phenylpropanamide |
| InChIKey | WIHRUDKZTYLJLT-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)C(=O)NC2=CC(=C(C=C2)N3CCN(CC3)C(=O)C4=C(C=CC=N4)OC)Cl |
Computed by PubChem (NCBI)