CAS 1185853-99-9 is the registry number for Fmoc-3-(2-methylthiazol-4-yl)-L-alanine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-methyl-1,3-thiazol-4-yl)propanoic acid (CAS 1185853-99-9) is a chemical compound with the molecular formula C22H20N2O4S and a molecular weight of 408.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-methyl-1,3-thiazol-4-yl)propanoic acid. InChIKey: UGAWXCXIXGKAHL-FQEVSTJZSA-N.
| Molecular formula | C22H20N2O4S |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-methyl-1,3-thiazol-4-yl)propanoic acid |
| InChIKey | UGAWXCXIXGKAHL-FQEVSTJZSA-N |
| SMILES | CC1=NC(=CS1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)