CAS 1185887-14-2 appears in our catalog under these names: APP-CHMINACA RM, APP–CHMINACA. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 1mg, 5mg, 50mg.
N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-(cyclohexylmethyl)indazole-3-carboxamide (CAS 1185887-14-2) is a chemical compound with the molecular formula C24H28N4O2 and a molecular weight of 404.5 g/mol. IUPAC name: N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-(cyclohexylmethyl)indazole-3-carboxamide. InChIKey: DMHWDSGURMXMGE-FQEVSTJZSA-N.
| Molecular formula | C24H28N4O2 |
|---|---|
| Molecular weight | 404.5 g/mol |
| IUPAC name | N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-(cyclohexylmethyl)indazole-3-carboxamide |
| InChIKey | DMHWDSGURMXMGE-FQEVSTJZSA-N |
| SMILES | C1CCC(CC1)CN2C3=CC=CC=C3C(=N2)C(=O)N[C@@H](CC4=CC=CC=C4)C(=O)N |
Computed by PubChem (NCBI)