CAS 1185888-30-5 appears in our catalog under these names: 4–cyano MDMB–BUTINACA, 4-Cyano MDMB-BUTINACA, >95% (HPLC), 4-Cyano mdmb-butinaca. Offered by: GLPBio, TRC, Biosynth. Available pack sizes: 5mg, 100mg, 10mg, 1mg, 25mg, 50mg.
Methyl (2S)-2-[[1-(4-cyanobutyl)indazole-3-carbonyl]amino]-3,3-dimethylbutanoate (CAS 1185888-30-5) is a chemical compound with the molecular formula C20H26N4O3 and a molecular weight of 370.4 g/mol. IUPAC name: methyl (2S)-2-[[1-(4-cyanobutyl)indazole-3-carbonyl]amino]-3,3-dimethylbutanoate. InChIKey: NXENAUQFMPGSRW-QGZVFWFLSA-N.
| Molecular formula | C20H26N4O3 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | methyl (2S)-2-[[1-(4-cyanobutyl)indazole-3-carbonyl]amino]-3,3-dimethylbutanoate |
| InChIKey | NXENAUQFMPGSRW-QGZVFWFLSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)OC)NC(=O)C1=NN(C2=CC=CC=C21)CCCCC#N |
Computed by PubChem (NCBI)