CAS 1185889-12-6 appears in our catalog under these names: MAB–CHMINACA metabolite M2, N-((1-(Cyclohexylmethyl)-1H-indazol-3-yl)carbonyl)-3-methyl-L-valine. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
(2S)-2-[[1-(cyclohexylmethyl)indazole-3-carbonyl]amino]-3,3-dimethylbutanoic acid (CAS 1185889-12-6) is a chemical compound with the molecular formula C21H29N3O3 and a molecular weight of 371.5 g/mol. IUPAC name: (2S)-2-[[1-(cyclohexylmethyl)indazole-3-carbonyl]amino]-3,3-dimethylbutanoic acid. InChIKey: BDFKDDNZVYVPRC-GOSISDBHSA-N.
| Molecular formula | C21H29N3O3 |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | (2S)-2-[[1-(cyclohexylmethyl)indazole-3-carbonyl]amino]-3,3-dimethylbutanoic acid |
| InChIKey | BDFKDDNZVYVPRC-GOSISDBHSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)C1=NN(C2=CC=CC=C21)CC3CCCCC3 |
Computed by PubChem (NCBI)