CAS 1186194-32-0 is the registry number for 2,6-Difluoro-3-(propylsulfonamido)benzoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-difluoro-3-(propylsulfonylamino)benzoyl chloride (CAS 1186194-32-0) is a chemical compound with the molecular formula C10H10ClF2NO3S and a molecular weight of 297.71 g/mol. IUPAC name: 2,6-difluoro-3-(propylsulfonylamino)benzoyl chloride. InChIKey: VISFLVDSLXMOOO-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF2NO3S |
|---|---|
| Molecular weight | 297.71 g/mol |
| IUPAC name | 2,6-difluoro-3-(propylsulfonylamino)benzoyl chloride |
| InChIKey | VISFLVDSLXMOOO-UHFFFAOYSA-N |
| SMILES | CCCS(=O)(=O)NC1=C(C(=C(C=C1)F)C(=O)Cl)F |
Computed by PubChem (NCBI)