Products 1186229-95-7

CAS 1186229-95-7 is the registry number for Lu AE51090, 99.51%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 50 mg, 100 mg, 10 mg, 25 mg.

Structural formula: {0} (CAS {1})

N-[1-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]piperidin-4-yl]-2-phenylacetamide (CAS 1186229-95-7) is a chemical compound with the molecular formula C24H29N3O3 and a molecular weight of 407.5 g/mol. IUPAC name: N-[1-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]piperidin-4-yl]-2-phenylacetamide. InChIKey: FLGSUSWMWSZVMP-UHFFFAOYSA-N.

Identity
Molecular formulaC24H29N3O3
Molecular weight407.5 g/mol
IUPAC nameN-[1-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]piperidin-4-yl]-2-phenylacetamide
InChIKeyFLGSUSWMWSZVMP-UHFFFAOYSA-N
SMILESC1CN(CCC1NC(=O)CC2=CC=CC=C2)CCCN3C(=O)COC4=CC=CC=C43

Computed by PubChem (NCBI)