Products 1186301-79-0
CAS 1186301-79-0 is the registry number for tert-Butyl (R)-2-methylpyrrolidine-2-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g, 100g.
Tert-butyl (2R)-2-methylpyrrolidine-2-carboxylate (CAS 1186301-79-0) is a chemical compound with the molecular formula C10H19NO2 and a molecular weight of 185.26 g/mol. IUPAC name: tert-butyl (2R)-2-methylpyrrolidine-2-carboxylate. InChIKey: WAOBLRSJQYXNJU-SNVBAGLBSA-N.
| Molecular formula | C10H19NO2 |
|---|---|
| Molecular weight | 185.26 g/mol |
| IUPAC name | tert-butyl (2R)-2-methylpyrrolidine-2-carboxylate |
| InChIKey | WAOBLRSJQYXNJU-SNVBAGLBSA-N |
| SMILES | C[C@@]1(CCCN1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)