CAS 1186310-77-9 is the registry number for 6-Chloro-2-(trimethylsilyl)furo[3,2-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(6-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane (CAS 1186310-77-9) is a chemical compound with the molecular formula C10H12ClNOSi and a molecular weight of 225.74 g/mol. IUPAC name: (6-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane. InChIKey: WUQLUIMCZRXJGD-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNOSi |
|---|---|
| Molecular weight | 225.74 g/mol |
| IUPAC name | (6-chlorofuro[3,2-b]pyridin-2-yl)-trimethylsilane |
| InChIKey | WUQLUIMCZRXJGD-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC2=C(O1)C=C(C=N2)Cl |
Computed by PubChem (NCBI)