CAS 1186655-16-2 is the registry number for (3S,4S)-1-(2-Ethoxyethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(3S,4S)-1-(2-ethoxyethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (CAS 1186655-16-2) is a chemical compound with the molecular formula C10H16F3NO3 and a molecular weight of 255.23 g/mol. IUPAC name: (3S,4S)-1-(2-ethoxyethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid. InChIKey: VWKJBJKCLHPFLX-HTQZYQBOSA-N.
| Molecular formula | C10H16F3NO3 |
|---|---|
| Molecular weight | 255.23 g/mol |
| IUPAC name | (3S,4S)-1-(2-ethoxyethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| InChIKey | VWKJBJKCLHPFLX-HTQZYQBOSA-N |
| SMILES | CCOCCN1C[C@H]([C@@H](C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)