CAS 1187-91-3 appears in our catalog under these names: DL-aspartic acid hemimagnesium salt, 95%, DL–Aspartic acid hemimagnesium salt, DL-Aspartic acid hemimagnesium salt, DL-Aspartic acid (hemimagnesium salt). Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 100mg, 500g, 25g, 100g, Get quote.
Magnesium;2-amino-4-hydroxy-4-oxobutanoate;hydrate (CAS 1187-91-3) is a chemical compound with the molecular formula C4H8MgNO5+ and a molecular weight of 174.42 g/mol. IUPAC name: magnesium;2-amino-4-hydroxy-4-oxobutanoate;hydrate. InChIKey: CVBGIEUREJGNAI-UHFFFAOYSA-M.
| Molecular formula | C4H8MgNO5+ |
|---|---|
| Molecular weight | 174.42 g/mol |
| IUPAC name | magnesium;2-amino-4-hydroxy-4-oxobutanoate;hydrate |
| InChIKey | CVBGIEUREJGNAI-UHFFFAOYSA-M |
| SMILES | C(C(C(=O)[O-])N)C(=O)O.O.[Mg+2] |
Computed by PubChem (NCBI)