CAS 118726-30-0 is the registry number for 3–Chlorobenzo(4,5)thieno(2,3–b)pyridine. Offered by: GLPBio. Available pack sizes: 1g.
3-chloro-[1]benzothiolo[2,3-b]pyridine (CAS 118726-30-0) is a chemical compound with the molecular formula C11H6ClNS and a molecular weight of 219.69 g/mol. IUPAC name: 3-chloro-[1]benzothiolo[2,3-b]pyridine. InChIKey: HBELBLQFXYBFFW-UHFFFAOYSA-N.
| Molecular formula | C11H6ClNS |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | 3-chloro-[1]benzothiolo[2,3-b]pyridine |
| InChIKey | HBELBLQFXYBFFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)N=CC(=C3)Cl |
Computed by PubChem (NCBI)