CAS 1187310-14-0 is the registry number for Atropine Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,5S)-N,8-dimethyl-8-azabicyclo[3.2.1]octan-3-amine (CAS 1187310-14-0) is a chemical compound with the molecular formula C9H18N2 and a molecular weight of 154.25 g/mol. IUPAC name: (1R,5S)-N,8-dimethyl-8-azabicyclo[3.2.1]octan-3-amine. InChIKey: WOPJGCHLBFCBLZ-CBLAIPOGSA-N.
| Molecular formula | C9H18N2 |
|---|---|
| Molecular weight | 154.25 g/mol |
| IUPAC name | (1R,5S)-N,8-dimethyl-8-azabicyclo[3.2.1]octan-3-amine |
| InChIKey | WOPJGCHLBFCBLZ-CBLAIPOGSA-N |
| SMILES | CNC1C[C@H]2CC[C@@H](C1)N2C |
Computed by PubChem (NCBI)