CAS 1187385-59-6 is the registry number for 5-Bromo-2-(3-methyl-5-(trifluoromethyl)pyrazol-1-yl)pyridine, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
5-bromo-2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]pyridine (CAS 1187385-59-6) is a chemical compound with the molecular formula C10H7BrF3N3 and a molecular weight of 306.08 g/mol. IUPAC name: 5-bromo-2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]pyridine. InChIKey: UCTOWEGQEJJLMV-UHFFFAOYSA-N.
| Molecular formula | C10H7BrF3N3 |
|---|---|
| Molecular weight | 306.08 g/mol |
| IUPAC name | 5-bromo-2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]pyridine |
| InChIKey | UCTOWEGQEJJLMV-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C(F)(F)F)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)