Products 1187385-63-2
CAS 1187385-63-2 appears in our catalog under these names: 2-(5-Bromopyridin-3-yl)-5-phenyl-1,3,4-oxadiazole, 98%, 2-(5-Bromopyridin-3-yl)-5-phenyl-1,3,4-oxadiazole, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 25g, 5g.
2-(5-bromo-3-pyridinyl)-5-phenyl-1,3,4-oxadiazole (CAS 1187385-63-2) is a chemical compound with the molecular formula C13H8BrN3O and a molecular weight of 302.13 g/mol. IUPAC name: 2-(5-bromo-3-pyridinyl)-5-phenyl-1,3,4-oxadiazole. InChIKey: MSUCGCFKPCQJKU-UHFFFAOYSA-N.
| Molecular formula | C13H8BrN3O |
|---|---|
| Molecular weight | 302.13 g/mol |
| IUPAC name | 2-(5-bromo-3-pyridinyl)-5-phenyl-1,3,4-oxadiazole |
| InChIKey | MSUCGCFKPCQJKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)C3=CC(=CN=C3)Br |
Computed by PubChem (NCBI)