CAS 1187385-78-9 is the registry number for 1-(4-Bromophenylsulfonyl)-4-isobutylpiperazine, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
1-(4-bromophenyl)sulfonyl-4-(2-methylpropyl)piperazine (CAS 1187385-78-9) is a chemical compound with the molecular formula C14H21BrN2O2S and a molecular weight of 361.30 g/mol. IUPAC name: 1-(4-bromophenyl)sulfonyl-4-(2-methylpropyl)piperazine. InChIKey: LARLQVYZLIPIBV-UHFFFAOYSA-N.
| Molecular formula | C14H21BrN2O2S |
|---|---|
| Molecular weight | 361.30 g/mol |
| IUPAC name | 1-(4-bromophenyl)sulfonyl-4-(2-methylpropyl)piperazine |
| InChIKey | LARLQVYZLIPIBV-UHFFFAOYSA-N |
| SMILES | CC(C)CN1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)