CAS 1187385-94-9 appears in our catalog under these names: 2-(4-Trifluoroacetylpiperazino)-5-bromopyridine, 96%, 1-(4-(5-Bromopyridin-2-yl)piperazin-1-yl)-2,2,2-trifluoroethanone, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]-2,2,2-trifluoroethanone (CAS 1187385-94-9) is a chemical compound with the molecular formula C11H11BrF3N3O and a molecular weight of 338.12 g/mol. IUPAC name: 1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]-2,2,2-trifluoroethanone. InChIKey: NVHLCNLQVWVSBA-UHFFFAOYSA-N.
| Molecular formula | C11H11BrF3N3O |
|---|---|
| Molecular weight | 338.12 g/mol |
| IUPAC name | 1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]-2,2,2-trifluoroethanone |
| InChIKey | NVHLCNLQVWVSBA-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=NC=C(C=C2)Br)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)